C37H30N2 — CID 144925079
(3Z)-5-[3-[3-methyl-1-phenyl-2-[(1E)-2-phenylbuta-1,3-dienyl]indol-6-yl]phenyl]hexa-3,5-dienenitrile (PubChem CID 144925079) has the molecular formula C37H30N2 and a molecular weight of 502.66 g/mol. Its IUPAC name is (3Z)-5-[3-[3-methyl-1-phenyl-2-[(1E)-2-phenylbuta-1,3-dienyl]indol-6-yl]phenyl]hexa-3,5-dienenitrile.
| Compound Name | (3Z)-5-[3-[3-methyl-1-phenyl-2-[(1E)-2-phenylbuta-1,3-dienyl]indol-6-yl]phenyl]hexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 144925079 |
| Molecular Formula | C37H30N2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | (3Z)-5-[3-[3-methyl-1-phenyl-2-[(1E)-2-phenylbuta-1,3-dienyl]indol-6-yl]phenyl]hexa-3,5-dienenitrile |
| SMILES | C=C/C(=C\c1c(C)c2ccc(-c3cccc(C(=C)/C=C\CC#N)c3)cc2n1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H30N2/c1-4-29(30-15-7-5-8-16-30)25-36-28(3)35-22-21-33(26-37(35)39(36)34-19-9-6-10-20-34)32-18-13-17-31(24-32)27(2)14-11-12-23-38/h4-11,13-22,24-26H,1-2,12H2,3H3/b14-11-,29-25+ |
| InChIKey | HDBZQLAKDOLTBX-FMHOACGRSA-N |
| XLogP | 9.82 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|