C19H27NOS — CID 144925773
4-[(6Z)-6-ethenylnona-6,8-dienyl]-N-ethylbenzenesulfinamide (PubChem CID 144925773) has the molecular formula C19H27NOS and a molecular weight of 317.50 g/mol. Its IUPAC name is 4-[(6Z)-6-ethenylnona-6,8-dienyl]-N-ethylbenzenesulfinamide.
| Compound Name | 4-[(6Z)-6-ethenylnona-6,8-dienyl]-N-ethylbenzenesulfinamide |
|---|---|
| PubChem CID | 144925773 |
| Molecular Formula | C19H27NOS |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 4-[(6Z)-6-ethenylnona-6,8-dienyl]-N-ethylbenzenesulfinamide |
| SMILES | C=C/C=C(\C=C)CCCCCc1ccc(S(=O)NCC)cc1 |
| InChI | InChI=1S/C19H27NOS/c1-4-10-17(5-2)11-8-7-9-12-18-13-15-19(16-14-18)22(21)20-6-3/h4-5,10,13-16,20H,1-2,6-9,11-12H2,3H3/b17-10+ |
| InChIKey | IMEYKXFQQVHQLT-LICLKQGHSA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|