C31H32N2O3S — CID 144931387
2-[(5R)-3-[(2E)-2-ethenylpenta-2,4-dienoxy]-5,7-dimethyl-9-(4-methylphenyl)-6-methylsulfanyl-5H-benzo[h][1,6]naphthyridin-8-yl]acetic acid (PubChem CID 144931387) has the molecular formula C31H32N2O3S and a molecular weight of 512.68 g/mol. Its IUPAC name is 2-[(5R)-3-[(2E)-2-ethenylpenta-2,4-dienoxy]-5,7-dimethyl-9-(4-methylphenyl)-6-methylsulfanyl-5H-benzo[h][1,6]naphthyridin-8-yl]acetic acid.
| Compound Name | 2-[(5R)-3-[(2E)-2-ethenylpenta-2,4-dienoxy]-5,7-dimethyl-9-(4-methylphenyl)-6-methylsulfanyl-5H-benzo[h][1,6]naphthyridin-8-yl]acetic acid |
|---|---|
| PubChem CID | 144931387 |
| Molecular Formula | C31H32N2O3S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 2-[(5R)-3-[(2E)-2-ethenylpenta-2,4-dienoxy]-5,7-dimethyl-9-(4-methylphenyl)-6-methylsulfanyl-5H-benzo[h][1,6]naphthyridin-8-yl]acetic acid |
| SMILES | C=C/C=C(\C=C)COc1cnc2c(c1)[C@@H](C)N(SC)c1c-2cc(-c2ccc(C)cc2)c(CC(=O)O)c1C |
| InChI | InChI=1S/C31H32N2O3S/c1-7-9-22(8-2)18-36-24-14-26-21(5)33(37-6)31-20(4)25(16-29(34)35)27(15-28(31)30(26)32-17-24)23-12-10-19(3)11-13-23/h7-15,17,21H,1-2,16,18H2,3-6H3,(H,34,35)/b22-9+/t21-/m1/s1 |
| InChIKey | VQVZQMUCGJPUPW-PFDQHCLKSA-N |
| XLogP | 7.50 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|