C36H38N2OS — CID 144931886
2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-9-[(3R)-3-phenylpiperidin-1-yl]-6H-phenanthridin-3-yl]acetaldehyde (PubChem CID 144931886) has the molecular formula C36H38N2OS and a molecular weight of 546.78 g/mol. Its IUPAC name is 2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-9-[(3R)-3-phenylpiperidin-1-yl]-6H-phenanthridin-3-yl]acetaldehyde.
| Compound Name | 2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-9-[(3R)-3-phenylpiperidin-1-yl]-6H-phenanthridin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 144931886 |
| Molecular Formula | C36H38N2OS |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | 2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-9-[(3R)-3-phenylpiperidin-1-yl]-6H-phenanthridin-3-yl]acetaldehyde |
| SMILES | CSN1Cc2ccc(N3CCC[C@H](c4ccccc4)C3)cc2-c2c(C)c(-c3ccc(C)cc3)c(CC=O)c(C)c21 |
| InChI | InChI=1S/C36H38N2OS/c1-24-12-14-28(15-13-24)34-26(3)35-33-21-31(37-19-8-11-29(22-37)27-9-6-5-7-10-27)17-16-30(33)23-38(40-4)36(35)25(2)32(34)18-20-39/h5-7,9-10,12-17,20-21,29H,8,11,18-19,22-23H2,1-4H3/t29-/m0/s1 |
| InChIKey | XRTWRFGUAPZUFG-LJAQVGFWSA-N |
| XLogP | 8.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|