C28H36N11+ — CID 144936801
imino(5,7,14,17,20,27,29,32-octazahexacyclo[26.2.2.214,17.12,6.18,12.023,27]hexatriaconta-1(30),2(36),3,5,8,10,12(35),28,31-nonaen-25-ylimino)azanium (PubChem CID 144936801) has the molecular formula C28H36N11+ and a molecular weight of 526.67 g/mol. Its IUPAC name is imino(5,7,14,17,20,27,29,32-octazahexacyclo[26.2.2.214,17.12,6.18,12.023,27]hexatriaconta-1(30),2(36),3,5,8,10,12(35),28,31-nonaen-25-ylimino)azanium.
| Compound Name | imino(5,7,14,17,20,27,29,32-octazahexacyclo[26.2.2.214,17.12,6.18,12.023,27]hexatriaconta-1(30),2(36),3,5,8,10,12(35),28,31-nonaen-25-ylimino)azanium |
|---|---|
| PubChem CID | 144936801 |
| Molecular Formula | C28H36N11+ |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | imino(5,7,14,17,20,27,29,32-octazahexacyclo[26.2.2.214,17.12,6.18,12.023,27]hexatriaconta-1(30),2(36),3,5,8,10,12(35),28,31-nonaen-25-ylimino)azanium |
| SMILES | N=[N+]=NC1CC2CCNCCN3CCN(CC3)Cc3cccc(c3)Nc3cc(ccn3)-c3cnc(nc3)N2C1 |
| InChI | InChI=1S/C28H36N11/c29-36-35-25-16-26-5-6-30-8-9-37-10-12-38(13-11-37)19-21-2-1-3-24(14-21)34-27-15-22(4-7-31-27)23-17-32-28(33-18-23)39(26)20-25/h1-4,7,14-15,17-18,25-26,29-30H,5-6,8-13,16,19-20H2,(H,31,34)/q+1 |
| InChIKey | QYWZGSSHVNKNLZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|