C10H17FN2 — CID 144940616
1-ethyl-2-[(3Z,5Z)-7-fluoro-6-methylhepta-1,3,5-trien-2-yl]hydrazine (PubChem CID 144940616) has the molecular formula C10H17FN2 and a molecular weight of 184.26 g/mol. Its IUPAC name is 1-ethyl-2-[(3Z,5Z)-7-fluoro-6-methylhepta-1,3,5-trien-2-yl]hydrazine.
| Compound Name | 1-ethyl-2-[(3Z,5Z)-7-fluoro-6-methylhepta-1,3,5-trien-2-yl]hydrazine |
|---|---|
| PubChem CID | 144940616 |
| Molecular Formula | C10H17FN2 |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | 1-ethyl-2-[(3Z,5Z)-7-fluoro-6-methylhepta-1,3,5-trien-2-yl]hydrazine |
| SMILES | C=C(/C=C\C=C(\C)CF)NNCC |
| InChI | InChI=1S/C10H17FN2/c1-4-12-13-10(3)7-5-6-9(2)8-11/h5-7,12-13H,3-4,8H2,1-2H3/b7-5-,9-6- |
| InChIKey | MOGPMPTVGBJZDX-BSIYMUDXSA-N |
| XLogP | 2.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|