C9H16N2 — CID 142007568
4,5-bis(ethenyl)-2,3-dihydro-1H-pyrazole;ethane (PubChem CID 142007568) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-2,3-dihydro-1H-pyrazole;ethane.
| Compound Name | 4,5-bis(ethenyl)-2,3-dihydro-1H-pyrazole;ethane |
|---|---|
| PubChem CID | 142007568 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 4,5-bis(ethenyl)-2,3-dihydro-1H-pyrazole;ethane |
| SMILES | C=CC1=C(C=C)NNC1.CC |
| InChI | InChI=1S/C7H10N2.C2H6/c1-3-6-5-8-9-7(6)4-2;1-2/h3-4,8-9H,1-2,5H2;1-2H3 |
| InChIKey | TZEUIEGNTLPLAM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |