C10H16N2 — CID 143036173
ethane;1,2,3,6-tetrahydrocyclohepta[c]pyrazole (PubChem CID 143036173) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is ethane;1,2,3,6-tetrahydrocyclohepta[c]pyrazole.
| Compound Name | ethane;1,2,3,6-tetrahydrocyclohepta[c]pyrazole |
|---|---|
| PubChem CID | 143036173 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | ethane;1,2,3,6-tetrahydrocyclohepta[c]pyrazole |
| SMILES | C1=CC2=C(C=CC1)NNC2.CC |
| InChI | InChI=1S/C8H10N2.C2H6/c1-2-4-7-6-9-10-8(7)5-3-1;1-2/h2-5,9-10H,1,6H2;1-2H3 |
| InChIKey | QPBUSOLMBOTEJC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |