C9H17N3 — CID 142986206
(2Z,4E,6Z)-4-hydrazinylnona-2,4,6-trien-1-amine (PubChem CID 142986206) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (2Z,4E,6Z)-4-hydrazinylnona-2,4,6-trien-1-amine.
| Compound Name | (2Z,4E,6Z)-4-hydrazinylnona-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 142986206 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (2Z,4E,6Z)-4-hydrazinylnona-2,4,6-trien-1-amine |
| SMILES | CC/C=C\C=C(/C=C\CN)NN |
| InChI | InChI=1S/C9H17N3/c1-2-3-4-6-9(12-11)7-5-8-10/h3-7,12H,2,8,10-11H2,1H3/b4-3-,7-5-,9-6+ |
| InChIKey | UQLGIKFOLXHPLG-CGFWPMDESA-N |
| XLogP | 0.81 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|