C11H22N2 — CID 143245771
4,5-bis(ethenyl)-2,3-dihydro-1H-pyrazole;ethane (PubChem CID 143245771) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-2,3-dihydro-1H-pyrazole;ethane.
| Compound Name | 4,5-bis(ethenyl)-2,3-dihydro-1H-pyrazole;ethane |
|---|---|
| PubChem CID | 143245771 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 4,5-bis(ethenyl)-2,3-dihydro-1H-pyrazole;ethane |
| SMILES | C=CC1=C(C=C)NNC1.CC.CC |
| InChI | InChI=1S/C7H10N2.2C2H6/c1-3-6-5-8-9-7(6)4-2;2*1-2/h3-4,8-9H,1-2,5H2;2*1-2H3 |
| InChIKey | NLBWRTFQNDHDRI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |