C12H27N — CID 144941558
(3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;ethane;propane (PubChem CID 144941558) has the molecular formula C12H27N and a molecular weight of 185.36 g/mol. Its IUPAC name is (3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;ethane;propane.
| Compound Name | (3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;ethane;propane |
|---|---|
| PubChem CID | 144941558 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.36 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | (3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;ethane;propane |
| SMILES | C1C[C@@H]2CNC[C@@H]2C1.CC.CCC |
| InChI | InChI=1S/C7H13N.C3H8.C2H6/c1-2-6-4-8-5-7(6)3-1;1-3-2;1-2/h6-8H,1-5H2;3H2,1-2H3;1-2H3/t6-,7+;; |
| InChIKey | YQCPEQWVFBKEQC-DTQHMAPFSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |