C14H29N — CID 156888577
ethane;4-ethyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-cyclohepta[c]pyridine (PubChem CID 156888577) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is ethane;4-ethyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-cyclohepta[c]pyridine.
| Compound Name | ethane;4-ethyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-cyclohepta[c]pyridine |
|---|---|
| PubChem CID | 156888577 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | ethane;4-ethyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-cyclohepta[c]pyridine |
| SMILES | CC.CCC1CNCC2CCCCCC12 |
| InChI | InChI=1S/C12H23N.C2H6/c1-2-10-8-13-9-11-6-4-3-5-7-12(10)11;1-2/h10-13H,2-9H2,1H3;1-2H3 |
| InChIKey | BKZRQODRHPWMRW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |