C27H46N2 — CID 144942660
N,N',3,7-tetramethyl-N-(4-methylcyclohexa-1,3-dien-1-yl)-N'-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]nonane-1,9-diamine (PubChem CID 144942660) has the molecular formula C27H46N2 and a molecular weight of 398.68 g/mol. Its IUPAC name is N,N',3,7-tetramethyl-N-(4-methylcyclohexa-1,3-dien-1-yl)-N'-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]nonane-1,9-diamine.
| Compound Name | N,N',3,7-tetramethyl-N-(4-methylcyclohexa-1,3-dien-1-yl)-N'-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]nonane-1,9-diamine |
|---|---|
| PubChem CID | 144942660 |
| Molecular Formula | C27H46N2 |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 398.37 |
| IUPAC Name | N,N',3,7-tetramethyl-N-(4-methylcyclohexa-1,3-dien-1-yl)-N'-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]nonane-1,9-diamine |
| SMILES | C=C(C)/C=C\C(=C)N(C)CCC(C)CCCC(C)CCN(C)C1=CC=C(C)CC1 |
| InChI | InChI=1S/C27H46N2/c1-22(2)12-15-26(6)28(7)20-18-23(3)10-9-11-24(4)19-21-29(8)27-16-13-25(5)14-17-27/h12-13,15-16,23-24H,1,6,9-11,14,17-21H2,2-5,7-8H3/b15-12- |
| InChIKey | QCBKZUICBHBRBZ-QINSGFPZSA-N |
| XLogP | 7.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|