C17H24FN — CID 170020840
(3E)-N-ethynyl-N-[[(3S)-5-fluoro-3-methylcyclohexen-1-yl]methyl]-4-methylhexa-1,3-dien-2-amine (PubChem CID 170020840) has the molecular formula C17H24FN and a molecular weight of 261.38 g/mol. Its IUPAC name is (3E)-N-ethynyl-N-[[(3S)-5-fluoro-3-methylcyclohexen-1-yl]methyl]-4-methylhexa-1,3-dien-2-amine.
| Compound Name | (3E)-N-ethynyl-N-[[(3S)-5-fluoro-3-methylcyclohexen-1-yl]methyl]-4-methylhexa-1,3-dien-2-amine |
|---|---|
| PubChem CID | 170020840 |
| Molecular Formula | C17H24FN |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | (3E)-N-ethynyl-N-[[(3S)-5-fluoro-3-methylcyclohexen-1-yl]methyl]-4-methylhexa-1,3-dien-2-amine |
| SMILES | C#CN(CC1=C[C@@H](C)CC(F)C1)C(=C)/C=C(\C)CC |
| InChI | InChI=1S/C17H24FN/c1-6-13(3)8-15(5)19(7-2)12-16-9-14(4)10-17(18)11-16/h2,8-9,14,17H,5-6,10-12H2,1,3-4H3/b13-8+/t14-,17?/m1/s1 |
| InChIKey | HBLYALJDLASEAJ-RLXQHOJCSA-N |
| XLogP | 4.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|