C16H22FN — CID 167169453
N-[1-(4-fluorocyclohexa-1,3-dien-1-yl)ethenyl]-N,4-dimethylcyclohex-3-en-1-amine (PubChem CID 167169453) has the molecular formula C16H22FN and a molecular weight of 247.36 g/mol. Its IUPAC name is N-[1-(4-fluorocyclohexa-1,3-dien-1-yl)ethenyl]-N,4-dimethylcyclohex-3-en-1-amine.
| Compound Name | N-[1-(4-fluorocyclohexa-1,3-dien-1-yl)ethenyl]-N,4-dimethylcyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 167169453 |
| Molecular Formula | C16H22FN |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | N-[1-(4-fluorocyclohexa-1,3-dien-1-yl)ethenyl]-N,4-dimethylcyclohex-3-en-1-amine |
| SMILES | C=C(C1=CC=C(F)CC1)N(C)C1CC=C(C)CC1 |
| InChI | InChI=1S/C16H22FN/c1-12-4-10-16(11-5-12)18(3)13(2)14-6-8-15(17)9-7-14/h4,6,8,16H,2,5,7,9-11H2,1,3H3 |
| InChIKey | QWVVQCQXHJMTHC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|