About ethane;4-oxopyran-2-carboxylic acid
ethane;4-oxopyran-2-carboxylic acid (PubChem CID 144946008) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is ethane;4-oxopyran-2-carboxylic acid.
Molecular Properties
| Compound Name | ethane;4-oxopyran-2-carboxylic acid |
| PubChem CID | 144946008 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | ethane;4-oxopyran-2-carboxylic acid |
| SMILES | CC.O=C(O)c1cc(=O)cco1 |
| InChI | InChI=1S/C6H4O4.C2H6/c7-4-1-2-10-5(3-4)6(8)9;1-2/h1-3H,(H,8,9);1-2H3 |
| InChIKey | BTQMDMLPMOUPNS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-oxopyran-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-oxopyran-2-carboxylic acid?
The IUPAC name of ethane;4-oxopyran-2-carboxylic acid (CID 144946008) is ethane;4-oxopyran-2-carboxylic acid.
What is the SMILES notation for ethane;4-oxopyran-2-carboxylic acid?
The canonical SMILES for ethane;4-oxopyran-2-carboxylic acid is CC.O=C(O)c1cc(=O)cco1.
What is the InChIKey of ethane;4-oxopyran-2-carboxylic acid?
The InChIKey is BTQMDMLPMOUPNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O4.C2H6/c7-4-1-2-10-5(3-4)6(8)9;1-2/h1-3H,(H,8,9);1-2H3.
What are the key properties of ethane;4-oxopyran-2-carboxylic acid?
ethane;4-oxopyran-2-carboxylic acid has a molecular weight of 170.16 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-oxopyran-2-carboxylic acid is sourced from PubChem (CID 144946008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).