C22H25N5O4S — CID 144949526
N-[2-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-5-(2-methylpyrimidin-5-yl)-1,3-thiazole-2-carboxamide (PubChem CID 144949526) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-[2-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-5-(2-methylpyrimidin-5-yl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-[2-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-5-(2-methylpyrimidin-5-yl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 144949526 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-[2-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-5-(2-methylpyrimidin-5-yl)-1,3-thiazole-2-carboxamide |
| SMILES | Cc1ncc(-c2cnc(C(=O)NC(C(=O)N3CC[C@H]4OCC(=O)[C@H]43)C3CCCC3)s2)cn1 |
| InChI | InChI=1S/C22H25N5O4S/c1-12-23-8-14(9-24-12)17-10-25-21(32-17)20(29)26-18(13-4-2-3-5-13)22(30)27-7-6-16-19(27)15(28)11-31-16/h8-10,13,16,18-19H,2-7,11H2,1H3,(H,26,29)/t16-,18?,19-/m1/s1 |
| InChIKey | VUNJGWWMTZBVOY-LPZUGFHBSA-N |
| XLogP | 1.77 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |