C23H27N5O4S — CID 144949629
N-[2-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(2-methylpyrimidin-5-yl)-1,3-thiazole-2-carboxamide (PubChem CID 144949629) has the molecular formula C23H27N5O4S and a molecular weight of 469.57 g/mol. Its IUPAC name is N-[2-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(2-methylpyrimidin-5-yl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-[2-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(2-methylpyrimidin-5-yl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 144949629 |
| Molecular Formula | C23H27N5O4S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[2-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(2-methylpyrimidin-5-yl)-1,3-thiazole-2-carboxamide |
| SMILES | Cc1ncc(-c2cnc(C(=O)NC(C(=O)N3CC[C@H]4OCC(=O)[C@H]43)C3CCCCC3)s2)cn1 |
| InChI | InChI=1S/C23H27N5O4S/c1-13-24-9-15(10-25-13)18-11-26-22(33-18)21(30)27-19(14-5-3-2-4-6-14)23(31)28-8-7-17-20(28)16(29)12-32-17/h9-11,14,17,19-20H,2-8,12H2,1H3,(H,27,30)/t17-,19?,20-/m1/s1 |
| InChIKey | UGWHBIDWKWRQOO-WWJDGXJASA-N |
| XLogP | 2.16 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |