C25H28ClN3O3S — CID 118477497
N-[(1S)-2-[(3R,3aS,6aS)-3-chloro-6-oxo-2,3,3a,4,5,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-5-phenyl-1,3-thiazole-2-carboxamide (PubChem CID 118477497) has the molecular formula C25H28ClN3O3S and a molecular weight of 486.04 g/mol. Its IUPAC name is N-[(1S)-2-[(3R,3aS,6aS)-3-chloro-6-oxo-2,3,3a,4,5,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-5-phenyl-1,3-thiazole-2-carboxamide.
| Compound Name | N-[(1S)-2-[(3R,3aS,6aS)-3-chloro-6-oxo-2,3,3a,4,5,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-5-phenyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 118477497 |
| Molecular Formula | C25H28ClN3O3S |
| Molecular Weight | 486.04 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | N-[(1S)-2-[(3R,3aS,6aS)-3-chloro-6-oxo-2,3,3a,4,5,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-5-phenyl-1,3-thiazole-2-carboxamide |
| SMILES | O=C(N[C@H](C(=O)N1C[C@H](Cl)[C@H]2CCC(=O)[C@H]21)C1CCCCC1)c1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C25H28ClN3O3S/c26-18-14-29(22-17(18)11-12-19(22)30)25(32)21(16-9-5-2-6-10-16)28-23(31)24-27-13-20(33-24)15-7-3-1-4-8-15/h1,3-4,7-8,13,16-18,21-22H,2,5-6,9-12,14H2,(H,28,31)/t17-,18+,21+,22+/m1/s1 |
| InChIKey | GKQNAJLMHVNOGH-KSCDAYEDSA-N |
| XLogP | 4.29 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.04 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|