C44H59ClNP — CID 144949971
5-chloro-5,5-dicyclohexyl-6-methyl-8,10-di(propan-2-yl)-10,10a-dihydro-6H-phosphanthridine;2-phenylaniline (PubChem CID 144949971) has the molecular formula C44H59ClNP and a molecular weight of 668.39 g/mol. Its IUPAC name is 5-chloro-5,5-dicyclohexyl-6-methyl-8,10-di(propan-2-yl)-10,10a-dihydro-6H-phosphanthridine;2-phenylaniline.
| Compound Name | 5-chloro-5,5-dicyclohexyl-6-methyl-8,10-di(propan-2-yl)-10,10a-dihydro-6H-phosphanthridine;2-phenylaniline |
|---|---|
| PubChem CID | 144949971 |
| Molecular Formula | C44H59ClNP |
| Molecular Weight | 668.39 g/mol |
| Exact Mass | 667.41 |
| IUPAC Name | 5-chloro-5,5-dicyclohexyl-6-methyl-8,10-di(propan-2-yl)-10,10a-dihydro-6H-phosphanthridine;2-phenylaniline |
| SMILES | CC(C)C1=CC(C(C)C)C2C(=C1)C(C)P(Cl)(C1CCCCC1)(C1CCCCC1)c1ccccc12.Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C32H48ClP.C12H11N/c1-22(2)25-20-29(23(3)4)32-28-18-12-13-19-31(28)34(33,24(5)30(32)21-25,26-14-8-6-9-15-26)27-16-10-7-11-17-27;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h12-13,18-24,26-27,29,32H,6-11,14-17H2,1-5H3;1-9H,13H2 |
| InChIKey | NHORRLXQHZVNKH-UHFFFAOYSA-N |
| XLogP | 12.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.39 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|