C19H26F3NO3 — CID 144950013
ethane;methoxymethane;2-[3-(6-methyl-2-pyridinyl)-5-(trifluoromethyl)phenoxy]ethanol (PubChem CID 144950013) has the molecular formula C19H26F3NO3 and a molecular weight of 373.42 g/mol. Its IUPAC name is ethane;methoxymethane;2-[3-(6-methyl-2-pyridinyl)-5-(trifluoromethyl)phenoxy]ethanol.
| Compound Name | ethane;methoxymethane;2-[3-(6-methyl-2-pyridinyl)-5-(trifluoromethyl)phenoxy]ethanol |
|---|---|
| PubChem CID | 144950013 |
| Molecular Formula | C19H26F3NO3 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | ethane;methoxymethane;2-[3-(6-methyl-2-pyridinyl)-5-(trifluoromethyl)phenoxy]ethanol |
| SMILES | CC.COC.Cc1cccc(-c2cc(OCCO)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C15H14F3NO2.C2H6O.C2H6/c1-10-3-2-4-14(19-10)11-7-12(15(16,17)18)9-13(8-11)21-6-5-20;1-3-2;1-2/h2-4,7-9,20H,5-6H2,1H3;1-2H3;1-2H3 |
| InChIKey | FSLZBHRWGIBKOZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |