C47H69N3O6S — CID 144956151
1-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]-3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione;methylsulfanylmethane (PubChem CID 144956151) has the molecular formula C47H69N3O6S and a molecular weight of 804.15 g/mol. Its IUPAC name is 1-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]-3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione;methylsulfanylmethane.
| Compound Name | 1-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]-3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione;methylsulfanylmethane |
|---|---|
| PubChem CID | 144956151 |
| Molecular Formula | C47H69N3O6S |
| Molecular Weight | 804.15 g/mol |
| Exact Mass | 803.49 |
| IUPAC Name | 1-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]-3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione;methylsulfanylmethane |
| SMILES | CSC.Cc1cc(Cn2c(=O)n(Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c(=O)n(Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C45H63N3O6.C2H6S/c1-26-17-27(18-30(35(26)49)41(2,3)4)23-46-38(52)47(24-28-19-31(42(5,6)7)36(50)32(20-28)43(8,9)10)40(54)48(39(46)53)25-29-21-33(44(11,12)13)37(51)34(22-29)45(14,15)16;1-3-2/h17-22,49-51H,23-25H2,1-16H3;1-2H3 |
| InChIKey | FMIZREOMDOSUNK-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.15 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |