C24H34N6O3 — CID 144957428
(2S)-2-[(1Z,2S)-1-amino-1-(aminohydrazinylidene)-3-[4-(6-piperidin-4-yloxy-2-pyridinyl)phenyl]propan-2-yl]pentanoic acid (PubChem CID 144957428) has the molecular formula C24H34N6O3 and a molecular weight of 454.58 g/mol. Its IUPAC name is (2S)-2-[(1Z,2S)-1-amino-1-(aminohydrazinylidene)-3-[4-(6-piperidin-4-yloxy-2-pyridinyl)phenyl]propan-2-yl]pentanoic acid.
| Compound Name | (2S)-2-[(1Z,2S)-1-amino-1-(aminohydrazinylidene)-3-[4-(6-piperidin-4-yloxy-2-pyridinyl)phenyl]propan-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 144957428 |
| Molecular Formula | C24H34N6O3 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (2S)-2-[(1Z,2S)-1-amino-1-(aminohydrazinylidene)-3-[4-(6-piperidin-4-yloxy-2-pyridinyl)phenyl]propan-2-yl]pentanoic acid |
| SMILES | CCC[C@H](C(=O)O)[C@H](Cc1ccc(-c2cccc(OC3CCNCC3)n2)cc1)/C(N)=N/NN |
| InChI | InChI=1S/C24H34N6O3/c1-2-4-19(24(31)32)20(23(25)29-30-26)15-16-7-9-17(10-8-16)21-5-3-6-22(28-21)33-18-11-13-27-14-12-18/h3,5-10,18-20,27,30H,2,4,11-15,26H2,1H3,(H2,25,29)(H,31,32)/t19-,20-/m0/s1 |
| InChIKey | AESROWKTGGRDQU-PMACEKPBSA-N |
| XLogP | 2.27 |
| TPSA | 147.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|