C23H42O2 — CID 144959784
ethane;[(3E,5E)-6,7,7-trimethylocta-1,3,5-trien-3-yl] 2-tert-butyl-2-methylpentanoate (PubChem CID 144959784) has the molecular formula C23H42O2 and a molecular weight of 350.59 g/mol. Its IUPAC name is ethane;[(3E,5E)-6,7,7-trimethylocta-1,3,5-trien-3-yl] 2-tert-butyl-2-methylpentanoate.
| Compound Name | ethane;[(3E,5E)-6,7,7-trimethylocta-1,3,5-trien-3-yl] 2-tert-butyl-2-methylpentanoate |
|---|---|
| PubChem CID | 144959784 |
| Molecular Formula | C23H42O2 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.32 |
| IUPAC Name | ethane;[(3E,5E)-6,7,7-trimethylocta-1,3,5-trien-3-yl] 2-tert-butyl-2-methylpentanoate |
| SMILES | C=C/C(=C\C=C(/C)C(C)(C)C)OC(=O)C(C)(CCC)C(C)(C)C.CC |
| InChI | InChI=1S/C21H36O2.C2H6/c1-11-15-21(10,20(7,8)9)18(22)23-17(12-2)14-13-16(3)19(4,5)6;1-2/h12-14H,2,11,15H2,1,3-10H3;1-2H3/b16-13+,17-14+; |
| InChIKey | UAAFPTPLYQXZNZ-NXJYFNHCSA-N |
| XLogP | 7.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|