About potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide
potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide (PubChem CID 144961213) has the molecular formula C10H24KN3
and a molecular weight of 225.42 g/mol. Its IUPAC name is potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide.
Molecular Properties
| Compound Name | potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide |
| PubChem CID | 144961213 |
| Molecular Formula | C10H24KN3 |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide |
| SMILES | CC.C[N-]CCN1CCN(C)CC1.[K+] |
| InChI | InChI=1S/C8H18N3.C2H6.K/c1-9-3-4-11-7-5-10(2)6-8-11;1-2;/h3-8H2,1-2H3;1-2H3;/q-1;;+1 |
| InChIKey | IUNCECJLFMVKIP-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 20.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide?
The IUPAC name of potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide (CID 144961213) is potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide.
What is the SMILES notation for potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide?
The canonical SMILES for potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide is CC.C[N-]CCN1CCN(C)CC1.[K+].
What is the InChIKey of potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide?
The InChIKey is IUNCECJLFMVKIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N3.C2H6.K/c1-9-3-4-11-7-5-10(2)6-8-11;1-2;/h3-8H2,1-2H3;1-2H3;/q-1;;+1.
What are the key properties of potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide?
potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide has a molecular weight of 225.42 g/mol, XLogP of -1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;ethane;methyl-[2-(4-methylpiperazin-1-yl)ethyl]azanide is sourced from PubChem (CID 144961213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).