C7H13NO4 — CID 144963344
3,4-dihydroxyoxane-2-carbonitrile;methanol (PubChem CID 144963344) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is 3,4-dihydroxyoxane-2-carbonitrile;methanol.
| Compound Name | 3,4-dihydroxyoxane-2-carbonitrile;methanol |
|---|---|
| PubChem CID | 144963344 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 3,4-dihydroxyoxane-2-carbonitrile;methanol |
| SMILES | CO.N#CC1OCCC(O)C1O |
| InChI | InChI=1S/C6H9NO3.CH4O/c7-3-5-6(9)4(8)1-2-10-5;1-2/h4-6,8-9H,1-2H2;2H,1H3 |
| InChIKey | VOXJEELYAXOOFP-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |