C7H11NO2 — CID 139575404
(2R,3R,4S)-3-amino-2-ethynyloxan-4-ol (PubChem CID 139575404) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (2R,3R,4S)-3-amino-2-ethynyloxan-4-ol.
| Compound Name | (2R,3R,4S)-3-amino-2-ethynyloxan-4-ol |
|---|---|
| PubChem CID | 139575404 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (2R,3R,4S)-3-amino-2-ethynyloxan-4-ol |
| SMILES | C#C[C@H]1OCC[C@H](O)[C@H]1N |
| InChI | InChI=1S/C7H11NO2/c1-2-6-7(8)5(9)3-4-10-6/h1,5-7,9H,3-4,8H2/t5-,6+,7+/m0/s1 |
| InChIKey | QKDDUHFSKKSRSE-RRKCRQDMSA-N |
| XLogP | -0.90 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|