About tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol
tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol (PubChem CID 144969977) has the molecular formula C20H30OS
and a molecular weight of 318.53 g/mol. Its IUPAC name is tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol.
Molecular Properties
| Compound Name | tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol |
| PubChem CID | 144969977 |
| Molecular Formula | C20H30OS |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol |
| SMILES | CC(C)(C)S(C)(c1ccccc1)c1ccccc1.CCCO |
| InChI | InChI=1S/C17H22S.C3H8O/c1-17(2,3)18(4,15-11-7-5-8-12-15)16-13-9-6-10-14-16;1-2-3-4/h5-14H,1-4H3;4H,2-3H2,1H3 |
| InChIKey | GPZHMDSSYAUVHI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol?
The IUPAC name of tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol (CID 144969977) is tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol.
What is the SMILES notation for tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol?
The canonical SMILES for tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol is CC(C)(C)S(C)(c1ccccc1)c1ccccc1.CCCO.
What is the InChIKey of tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol?
The InChIKey is GPZHMDSSYAUVHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22S.C3H8O/c1-17(2,3)18(4,15-11-7-5-8-12-15)16-13-9-6-10-14-16;1-2-3-4/h5-14H,1-4H3;4H,2-3H2,1H3.
What are the key properties of tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol?
tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol has a molecular weight of 318.53 g/mol, XLogP of 5.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-methyl-diphenyl-λ4-sulfane;propan-1-ol is sourced from PubChem (CID 144969977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).