C18H34N2O6 — CID 144971171
N-[2-(2-hydroxyethoxy)ethyl]-N'-[2-(2-hydroxyethoxy)ethylidene]decanediamide (PubChem CID 144971171) has the molecular formula C18H34N2O6 and a molecular weight of 374.48 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-N'-[2-(2-hydroxyethoxy)ethylidene]decanediamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-N'-[2-(2-hydroxyethoxy)ethylidene]decanediamide |
|---|---|
| PubChem CID | 144971171 |
| Molecular Formula | C18H34N2O6 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-N'-[2-(2-hydroxyethoxy)ethylidene]decanediamide |
| SMILES | O=C(CCCCCCCCC(=O)NCCOCCO)/N=C/COCCO |
| InChI | InChI=1S/C18H34N2O6/c21-11-15-25-13-9-19-17(23)7-5-3-1-2-4-6-8-18(24)20-10-14-26-16-12-22/h9,21-22H,1-8,10-16H2,(H,20,24)/b19-9+ |
| InChIKey | JZBHLRXGQRGXQI-DJKKODMXSA-N |
| XLogP | 0.84 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|