C22H20FN3O2 — CID 144972833
(6S)-6-(2,3-dimethylphenyl)-2-(4-fluorophenyl)-N-hydroxy-5,7-dihydrocyclopenta[d]pyrimidine-6-carboxamide (PubChem CID 144972833) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is (6S)-6-(2,3-dimethylphenyl)-2-(4-fluorophenyl)-N-hydroxy-5,7-dihydrocyclopenta[d]pyrimidine-6-carboxamide.
| Compound Name | (6S)-6-(2,3-dimethylphenyl)-2-(4-fluorophenyl)-N-hydroxy-5,7-dihydrocyclopenta[d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 144972833 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | (6S)-6-(2,3-dimethylphenyl)-2-(4-fluorophenyl)-N-hydroxy-5,7-dihydrocyclopenta[d]pyrimidine-6-carboxamide |
| SMILES | Cc1cccc([C@]2(C(=O)NO)Cc3cnc(-c4ccc(F)cc4)nc3C2)c1C |
| InChI | InChI=1S/C22H20FN3O2/c1-13-4-3-5-18(14(13)2)22(21(27)26-28)10-16-12-24-20(25-19(16)11-22)15-6-8-17(23)9-7-15/h3-9,12,28H,10-11H2,1-2H3,(H,26,27)/t22-/m0/s1 |
| InChIKey | YCMFXITVENSUBQ-QFIPXVFZSA-N |
| XLogP | 3.44 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|