C35H30N4 — CID 144976741
2-[(1Z)-buta-1,3-dienyl]-1-[(3Z)-1-(3,5-dipyridin-2-ylphenyl)hexa-1,3,5-trien-2-yl]-3-methylindol-5-amine (PubChem CID 144976741) has the molecular formula C35H30N4 and a molecular weight of 506.65 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-1-[(3Z)-1-(3,5-dipyridin-2-ylphenyl)hexa-1,3,5-trien-2-yl]-3-methylindol-5-amine.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-1-[(3Z)-1-(3,5-dipyridin-2-ylphenyl)hexa-1,3,5-trien-2-yl]-3-methylindol-5-amine |
|---|---|
| PubChem CID | 144976741 |
| Molecular Formula | C35H30N4 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-1-[(3Z)-1-(3,5-dipyridin-2-ylphenyl)hexa-1,3,5-trien-2-yl]-3-methylindol-5-amine |
| SMILES | C=C/C=C\C(=Cc1cc(-c2ccccn2)cc(-c2ccccn2)c1)n1c(/C=C\C=C)c(C)c2cc(N)ccc21 |
| InChI | InChI=1S/C35H30N4/c1-4-6-12-30(39-34(15-7-5-2)25(3)31-24-29(36)16-17-35(31)39)22-26-20-27(32-13-8-10-18-37-32)23-28(21-26)33-14-9-11-19-38-33/h4-24H,1-2,36H2,3H3/b12-6-,15-7-,30-22? |
| InChIKey | VVWQXKGKPGYUAB-HNPDKNPGSA-N |
| XLogP | 8.60 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|