C31H43N3O5 — CID 144978711
(Z)-2-amino-3-[(4-methoxyphenyl)methylamino]-N-(8-methyl-7-octan-4-yloxy-2-oxochromen-3-yl)prop-2-enamide;ethane (PubChem CID 144978711) has the molecular formula C31H43N3O5 and a molecular weight of 537.70 g/mol. Its IUPAC name is (Z)-2-amino-3-[(4-methoxyphenyl)methylamino]-N-(8-methyl-7-octan-4-yloxy-2-oxochromen-3-yl)prop-2-enamide;ethane.
| Compound Name | (Z)-2-amino-3-[(4-methoxyphenyl)methylamino]-N-(8-methyl-7-octan-4-yloxy-2-oxochromen-3-yl)prop-2-enamide;ethane |
|---|---|
| PubChem CID | 144978711 |
| Molecular Formula | C31H43N3O5 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | (Z)-2-amino-3-[(4-methoxyphenyl)methylamino]-N-(8-methyl-7-octan-4-yloxy-2-oxochromen-3-yl)prop-2-enamide;ethane |
| SMILES | CC.CCCCC(CCC)Oc1ccc2cc(NC(=O)/C(N)=C/NCc3ccc(OC)cc3)c(=O)oc2c1C |
| InChI | InChI=1S/C29H37N3O5.C2H6/c1-5-7-9-23(8-6-2)36-26-15-12-21-16-25(29(34)37-27(21)19(26)3)32-28(33)24(30)18-31-17-20-10-13-22(35-4)14-11-20;1-2/h10-16,18,23,31H,5-9,17,30H2,1-4H3,(H,32,33);1-2H3/b24-18-; |
| InChIKey | DTWJOTQZBNUHDG-XWASNXTISA-N |
| XLogP | 6.40 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|