C32H38F2N4O3S — CID 144994265
4-[4-[4-(fluoromethyl)phenyl]piperazin-1-yl]-1-[4-[4-(4-fluorophenyl)sulfonylanilino]piperidin-1-yl]butan-1-one (PubChem CID 144994265) has the molecular formula C32H38F2N4O3S and a molecular weight of 596.74 g/mol. Its IUPAC name is 4-[4-[4-(fluoromethyl)phenyl]piperazin-1-yl]-1-[4-[4-(4-fluorophenyl)sulfonylanilino]piperidin-1-yl]butan-1-one.
| Compound Name | 4-[4-[4-(fluoromethyl)phenyl]piperazin-1-yl]-1-[4-[4-(4-fluorophenyl)sulfonylanilino]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 144994265 |
| Molecular Formula | C32H38F2N4O3S |
| Molecular Weight | 596.74 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | 4-[4-[4-(fluoromethyl)phenyl]piperazin-1-yl]-1-[4-[4-(4-fluorophenyl)sulfonylanilino]piperidin-1-yl]butan-1-one |
| SMILES | O=C(CCCN1CCN(c2ccc(CF)cc2)CC1)N1CCC(Nc2ccc(S(=O)(=O)c3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H38F2N4O3S/c33-24-25-3-9-29(10-4-25)37-22-20-36(21-23-37)17-1-2-32(39)38-18-15-28(16-19-38)35-27-7-13-31(14-8-27)42(40,41)30-11-5-26(34)6-12-30/h3-14,28,35H,1-2,15-24H2 |
| InChIKey | LEHWHKWAHKYJHZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.74 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|