C24H41NO2 — CID 144994524
(4-propan-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-(aminomethyl)-2,4,4-trimethylpentanoate (PubChem CID 144994524) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is (4-propan-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-(aminomethyl)-2,4,4-trimethylpentanoate.
| Compound Name | (4-propan-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-(aminomethyl)-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 144994524 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | (4-propan-2-yl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-(aminomethyl)-2,4,4-trimethylpentanoate |
| SMILES | CC(C)C1(OC(=O)C(C)(CN)CC(C)(C)C)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C24H41NO2/c1-14(2)24(27-21(26)23(6,13-25)12-22(3,4)5)11-17-10-18(24)20-16-8-7-15(9-16)19(17)20/h14-20H,7-13,25H2,1-6H3 |
| InChIKey | CJDPMRYPOOOBEE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|