About 2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid
2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid (PubChem CID 170442949) has the molecular formula C18H28O4
and a molecular weight of 308.42 g/mol. Its IUPAC name is 2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid.
Molecular Properties
| Compound Name | 2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid |
| PubChem CID | 170442949 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid |
| SMILES | CC(C)C1(OC(=O)C(C)(C)C(=O)O)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C18H28O4/c1-10(2)18(22-16(21)17(3,4)15(19)20)9-11-8-14(18)13-7-5-6-12(11)13/h10-14H,5-9H2,1-4H3,(H,19,20) |
| InChIKey | JLIIJSRFBGTEGU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid?
The IUPAC name of 2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid (CID 170442949) is 2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid.
What is the SMILES notation for 2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid?
The canonical SMILES for 2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid is CC(C)C1(OC(=O)C(C)(C)C(=O)O)CC2CC1C1CCCC21.
What is the InChIKey of 2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid?
The InChIKey is JLIIJSRFBGTEGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O4/c1-10(2)18(22-16(21)17(3,4)15(19)20)9-11-8-14(18)13-7-5-6-12(11)13/h10-14H,5-9H2,1-4H3,(H,19,20).
What are the key properties of 2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid?
2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid has a molecular weight of 308.42 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-oxo-3-[(8-propan-2-yl-8-tricyclo[5.2.1.02,6]decanyl)oxy]propanoic acid is sourced from PubChem (CID 170442949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).