C20H20FN3OS — CID 145008001
5-(dimethylaminosulfanyl)-N-(2,4-dimethylquinolin-6-yl)-2-fluorobenzamide (PubChem CID 145008001) has the molecular formula C20H20FN3OS and a molecular weight of 369.47 g/mol. Its IUPAC name is 5-(dimethylaminosulfanyl)-N-(2,4-dimethylquinolin-6-yl)-2-fluorobenzamide.
| Compound Name | 5-(dimethylaminosulfanyl)-N-(2,4-dimethylquinolin-6-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 145008001 |
| Molecular Formula | C20H20FN3OS |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 5-(dimethylaminosulfanyl)-N-(2,4-dimethylquinolin-6-yl)-2-fluorobenzamide |
| SMILES | Cc1cc(C)c2cc(NC(=O)c3cc(SN(C)C)ccc3F)ccc2n1 |
| InChI | InChI=1S/C20H20FN3OS/c1-12-9-13(2)22-19-8-5-14(10-16(12)19)23-20(25)17-11-15(26-24(3)4)6-7-18(17)21/h5-11H,1-4H3,(H,23,25) |
| InChIKey | ICIHSGHPNRIZIO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|