C20H32F4N2O2S2 — CID 145015687
tert-butyl N-[C-[(3S)-3-(2,3-difluorophenyl)butan-2-yl]sulfanyl-N-methylcarbonimidoyl]-N-fluorosulfanylcarbamate;ethane;fluoromethane (PubChem CID 145015687) has the molecular formula C20H32F4N2O2S2 and a molecular weight of 472.61 g/mol. Its IUPAC name is tert-butyl N-[C-[(3S)-3-(2,3-difluorophenyl)butan-2-yl]sulfanyl-N-methylcarbonimidoyl]-N-fluorosulfanylcarbamate;ethane;fluoromethane.
| Compound Name | tert-butyl N-[C-[(3S)-3-(2,3-difluorophenyl)butan-2-yl]sulfanyl-N-methylcarbonimidoyl]-N-fluorosulfanylcarbamate;ethane;fluoromethane |
|---|---|
| PubChem CID | 145015687 |
| Molecular Formula | C20H32F4N2O2S2 |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | tert-butyl N-[C-[(3S)-3-(2,3-difluorophenyl)butan-2-yl]sulfanyl-N-methylcarbonimidoyl]-N-fluorosulfanylcarbamate;ethane;fluoromethane |
| SMILES | C/N=C(/SC(C)[C@@H](C)c1cccc(F)c1F)N(SF)C(=O)OC(C)(C)C.CC.CF |
| InChI | InChI=1S/C17H23F3N2O2S2.C2H6.CH3F/c1-10(12-8-7-9-13(18)14(12)19)11(2)25-15(21-6)22(26-20)16(23)24-17(3,4)5;2*1-2/h7-11H,1-6H3;1-2H3;1H3/b21-15+;;/t10-,11?;;/m1../s1 |
| InChIKey | IRQVYSRKUVVXKM-ZSYXCZHQSA-N |
| XLogP | 7.56 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|