About 1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide
1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide (PubChem CID 145018681) has the molecular formula C13H12BrN3O2S2
and a molecular weight of 386.30 g/mol. Its IUPAC name is 1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide.
Molecular Properties
| Compound Name | 1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide |
| PubChem CID | 145018681 |
| Molecular Formula | C13H12BrN3O2S2 |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | 1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide |
| SMILES | CC(=O)N1CCc2cc(Br)c(S(=O)Nc3nccs3)cc21 |
| InChI | InChI=1S/C13H12BrN3O2S2/c1-8(18)17-4-2-9-6-10(14)12(7-11(9)17)21(19)16-13-15-3-5-20-13/h3,5-7H,2,4H2,1H3,(H,15,16) |
| InChIKey | XAJWDLIFZQRDMU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide?
The IUPAC name of 1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide (CID 145018681) is 1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide.
What is the SMILES notation for 1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide?
The canonical SMILES for 1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide is CC(=O)N1CCc2cc(Br)c(S(=O)Nc3nccs3)cc21.
What is the InChIKey of 1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide?
The InChIKey is XAJWDLIFZQRDMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrN3O2S2/c1-8(18)17-4-2-9-6-10(14)12(7-11(9)17)21(19)16-13-15-3-5-20-13/h3,5-7H,2,4H2,1H3,(H,15,16).
What are the key properties of 1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide?
1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide has a molecular weight of 386.30 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-5-bromo-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-6-sulfinamide is sourced from PubChem (CID 145018681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).