C39H40BNO2 — CID 145019600
9,9-dimethyl-N-(4-phenylphenyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,3-dihydrofluoren-2-amine (PubChem CID 145019600) has the molecular formula C39H40BNO2 and a molecular weight of 565.57 g/mol. Its IUPAC name is 9,9-dimethyl-N-(4-phenylphenyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,3-dihydrofluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-(4-phenylphenyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,3-dihydrofluoren-2-amine |
|---|---|
| PubChem CID | 145019600 |
| Molecular Formula | C39H40BNO2 |
| Molecular Weight | 565.57 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | 9,9-dimethyl-N-(4-phenylphenyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,3-dihydrofluoren-2-amine |
| SMILES | CC1(C)C2=CC(N(c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)c3ccc(-c4ccccc4)cc3)CC=C2c2ccccc21 |
| InChI | InChI=1S/C39H40BNO2/c1-37(2)35-15-11-10-14-33(35)34-25-24-32(26-36(34)37)41(30-20-16-28(17-21-30)27-12-8-7-9-13-27)31-22-18-29(19-23-31)40-42-38(3,4)39(5,6)43-40/h7-23,25-26,32H,24H2,1-6H3 |
| InChIKey | YBHOEFCNGBHLDP-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.57 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|