C16H25FN2O — CID 145020058
ethane;4-(4-fluorophenyl)-N-propan-2-yl-1,2-oxazol-5-amine (PubChem CID 145020058) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is ethane;4-(4-fluorophenyl)-N-propan-2-yl-1,2-oxazol-5-amine.
| Compound Name | ethane;4-(4-fluorophenyl)-N-propan-2-yl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 145020058 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | ethane;4-(4-fluorophenyl)-N-propan-2-yl-1,2-oxazol-5-amine |
| SMILES | CC.CC.CC(C)Nc1oncc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FN2O.2C2H6/c1-8(2)15-12-11(7-14-16-12)9-3-5-10(13)6-4-9;2*1-2/h3-8,15H,1-2H3;2*1-2H3 |
| InChIKey | TXRCGBJECVSMRM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |