C25H31ClN2O5 — CID 145024032
(3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;6-chloro-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-ol;ethane (PubChem CID 145024032) has the molecular formula C25H31ClN2O5 and a molecular weight of 474.99 g/mol. Its IUPAC name is (3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;6-chloro-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-ol;ethane.
| Compound Name | (3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;6-chloro-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-ol;ethane |
|---|---|
| PubChem CID | 145024032 |
| Molecular Formula | C25H31ClN2O5 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | (3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;6-chloro-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-ol;ethane |
| SMILES | CC.OCC1(c2ccc(-c3nc4cc(O)[nH]c4cc3Cl)cc2)CC1.O[C@@H]1CO[C@@H]2CCOC12 |
| InChI | InChI=1S/C17H15ClN2O2.C6H10O3.C2H6/c18-12-7-13-14(8-15(22)19-13)20-16(12)10-1-3-11(4-2-10)17(9-21)5-6-17;7-4-3-9-5-1-2-8-6(4)5;1-2/h1-4,7-8,19,21-22H,5-6,9H2;4-7H,1-3H2;1-2H3/t;4-,5-,6?;/m.1./s1 |
| InChIKey | UMIMYIBPIJUDMP-DPMDSQGJSA-N |
| XLogP | 4.17 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |