C24H25FN2O4 — CID 90435074
(3S,3aR,6R,6aR)-3-[[6-fluoro-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol (PubChem CID 90435074) has the molecular formula C24H25FN2O4 and a molecular weight of 424.47 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-3-[[6-fluoro-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol.
| Compound Name | (3S,3aR,6R,6aR)-3-[[6-fluoro-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 90435074 |
| Molecular Formula | C24H25FN2O4 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (3S,3aR,6R,6aR)-3-[[6-fluoro-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
| SMILES | OCC1(c2ccc(-c3nc4cc(C[C@H]5CO[C@H]6[C@@H]5OC[C@H]6O)[nH]c4cc3F)cc2)CC1 |
| InChI | InChI=1S/C24H25FN2O4/c25-17-9-19-18(8-16(26-19)7-14-10-30-23-20(29)11-31-22(14)23)27-21(17)13-1-3-15(4-2-13)24(12-28)5-6-24/h1-4,8-9,14,20,22-23,26,28-29H,5-7,10-12H2/t14-,20+,22+,23+/m0/s1 |
| InChIKey | NHLMPJRKQSOYHE-QUFNARAZSA-N |
| XLogP | 2.71 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |