C28H29NO4 — CID 145026859
8-amino-9-[[(3R)-6-methoxy-2,4-dimethyloxan-3-yl]methyl]-3-methylbenzo[a]anthracene-7,12-dione (PubChem CID 145026859) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 8-amino-9-[[(3R)-6-methoxy-2,4-dimethyloxan-3-yl]methyl]-3-methylbenzo[a]anthracene-7,12-dione.
| Compound Name | 8-amino-9-[[(3R)-6-methoxy-2,4-dimethyloxan-3-yl]methyl]-3-methylbenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 145026859 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 8-amino-9-[[(3R)-6-methoxy-2,4-dimethyloxan-3-yl]methyl]-3-methylbenzo[a]anthracene-7,12-dione |
| SMILES | COC1CC(C)[C@@H](Cc2ccc3c(c2N)C(=O)c2ccc4cc(C)ccc4c2C3=O)C(C)O1 |
| InChI | InChI=1S/C28H29NO4/c1-14-5-8-19-17(11-14)6-9-20-24(19)27(30)21-10-7-18(26(29)25(21)28(20)31)13-22-15(2)12-23(32-4)33-16(22)3/h5-11,15-16,22-23H,12-13,29H2,1-4H3/t15?,16?,22-,23?/m1/s1 |
| InChIKey | IJBYIRPYSUEZKY-GXRUOTIGSA-N |
| XLogP | 5.08 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|