C27H25NO5 — CID 118927650
6-methoxy-4,8,20-trimethyl-7,10-dioxa-3-azahexacyclo[12.12.0.02,11.04,9.016,25.017,22]hexacosa-1(14),2(11),12,16(25),17(22),18,20,23-octaene-15,26-dione (PubChem CID 118927650) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 6-methoxy-4,8,20-trimethyl-7,10-dioxa-3-azahexacyclo[12.12.0.02,11.04,9.016,25.017,22]hexacosa-1(14),2(11),12,16(25),17(22),18,20,23-octaene-15,26-dione.
| Compound Name | 6-methoxy-4,8,20-trimethyl-7,10-dioxa-3-azahexacyclo[12.12.0.02,11.04,9.016,25.017,22]hexacosa-1(14),2(11),12,16(25),17(22),18,20,23-octaene-15,26-dione |
|---|---|
| PubChem CID | 118927650 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 6-methoxy-4,8,20-trimethyl-7,10-dioxa-3-azahexacyclo[12.12.0.02,11.04,9.016,25.017,22]hexacosa-1(14),2(11),12,16(25),17(22),18,20,23-octaene-15,26-dione |
| SMILES | COC1CC2(C)Nc3c(ccc4c3C(=O)c3ccc5cc(C)ccc5c3C4=O)OC2C(C)O1 |
| InChI | InChI=1S/C27H25NO5/c1-13-5-7-16-15(11-13)6-8-17-21(16)24(29)18-9-10-19-23(22(18)25(17)30)28-27(3)12-20(31-4)32-14(2)26(27)33-19/h5-11,14,20,26,28H,12H2,1-4H3 |
| InChIKey | SWDWFUFVNPTZFA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|