C19H26F2NOTl — CID 145027737
[4-[4-[(4-amino-2,3-difluorophenoxy)methyl]cyclohexyl]cyclohexyl]thallium (PubChem CID 145027737) has the molecular formula C19H26F2NOTl and a molecular weight of 526.80 g/mol. Its IUPAC name is [4-[4-[(4-amino-2,3-difluorophenoxy)methyl]cyclohexyl]cyclohexyl]thallium.
| Compound Name | [4-[4-[(4-amino-2,3-difluorophenoxy)methyl]cyclohexyl]cyclohexyl]thallium |
|---|---|
| PubChem CID | 145027737 |
| Molecular Formula | C19H26F2NOTl |
| Molecular Weight | 526.80 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | [4-[4-[(4-amino-2,3-difluorophenoxy)methyl]cyclohexyl]cyclohexyl]thallium |
| SMILES | Nc1ccc(OCC2CCC(C3CCC([Tl])CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C19H26F2NO.Tl/c20-18-16(22)10-11-17(19(18)21)23-12-13-6-8-15(9-7-13)14-4-2-1-3-5-14;/h1,10-11,13-15H,2-9,12,22H2; |
| InChIKey | UYPKNELYHDCDSM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.80 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|