C22H30F2N2O — CID 145295184
2,3-difluoro-4-[[4-[4-[(E)-3-iminoprop-1-enyl]cyclohexyl]cyclohexyl]methoxy]aniline (PubChem CID 145295184) has the molecular formula C22H30F2N2O and a molecular weight of 376.49 g/mol. Its IUPAC name is 2,3-difluoro-4-[[4-[4-[(E)-3-iminoprop-1-enyl]cyclohexyl]cyclohexyl]methoxy]aniline.
| Compound Name | 2,3-difluoro-4-[[4-[4-[(E)-3-iminoprop-1-enyl]cyclohexyl]cyclohexyl]methoxy]aniline |
|---|---|
| PubChem CID | 145295184 |
| Molecular Formula | C22H30F2N2O |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2,3-difluoro-4-[[4-[4-[(E)-3-iminoprop-1-enyl]cyclohexyl]cyclohexyl]methoxy]aniline |
| SMILES | [H]/N=C/C=C/C1CCC(C2CCC(COc3ccc(N)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C22H30F2N2O/c23-21-19(26)11-12-20(22(21)24)27-14-16-5-9-18(10-6-16)17-7-3-15(4-8-17)2-1-13-25/h1-2,11-13,15-18,25H,3-10,14,26H2/b2-1+,25-13+ |
| InChIKey | PHEHYOMMLQAYPX-HLJIXCGCSA-N |
| XLogP | 5.74 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|