C13H18N2O6 — CID 145030710
2-(methylamino)-N-(3,4,5-trihydroxyoxan-2-yl)oxybenzamide (PubChem CID 145030710) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-(methylamino)-N-(3,4,5-trihydroxyoxan-2-yl)oxybenzamide.
| Compound Name | 2-(methylamino)-N-(3,4,5-trihydroxyoxan-2-yl)oxybenzamide |
|---|---|
| PubChem CID | 145030710 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-(methylamino)-N-(3,4,5-trihydroxyoxan-2-yl)oxybenzamide |
| SMILES | CNc1ccccc1C(=O)NOC1OCC(O)C(O)C1O |
| InChI | InChI=1S/C13H18N2O6/c1-14-8-5-3-2-4-7(8)12(19)15-21-13-11(18)10(17)9(16)6-20-13/h2-5,9-11,13-14,16-18H,6H2,1H3,(H,15,19) |
| InChIKey | PZPABAOFWGRODC-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|