C26H28N4O2 — CID 145032537
tert-butyl N-[2-phenyl-1-[1-(3-pyrrol-1-ylphenyl)imidazol-2-yl]ethyl]carbamate (PubChem CID 145032537) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is tert-butyl N-[2-phenyl-1-[1-(3-pyrrol-1-ylphenyl)imidazol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-phenyl-1-[1-(3-pyrrol-1-ylphenyl)imidazol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 145032537 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | tert-butyl N-[2-phenyl-1-[1-(3-pyrrol-1-ylphenyl)imidazol-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)c1nccn1-c1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C26H28N4O2/c1-26(2,3)32-25(31)28-23(18-20-10-5-4-6-11-20)24-27-14-17-30(24)22-13-9-12-21(19-22)29-15-7-8-16-29/h4-17,19,23H,18H2,1-3H3,(H,28,31) |
| InChIKey | YLSGUZAEWFJWDK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |