C32H33FN6S — CID 145033912
(2E,4E)-5-fluoro-4-[1-[4-(5-prop-1-en-2-ylthiophen-2-yl)-1H-imidazo[4,5-c]pyridin-2-yl]ethenyl]-6-[5-(pyrrolidin-1-ylmethyl)-3-pyridinyl]hepta-2,4,6-trien-3-amine (PubChem CID 145033912) has the molecular formula C32H33FN6S and a molecular weight of 552.72 g/mol. Its IUPAC name is (2E,4E)-5-fluoro-4-[1-[4-(5-prop-1-en-2-ylthiophen-2-yl)-1H-imidazo[4,5-c]pyridin-2-yl]ethenyl]-6-[5-(pyrrolidin-1-ylmethyl)-3-pyridinyl]hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-5-fluoro-4-[1-[4-(5-prop-1-en-2-ylthiophen-2-yl)-1H-imidazo[4,5-c]pyridin-2-yl]ethenyl]-6-[5-(pyrrolidin-1-ylmethyl)-3-pyridinyl]hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 145033912 |
| Molecular Formula | C32H33FN6S |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | (2E,4E)-5-fluoro-4-[1-[4-(5-prop-1-en-2-ylthiophen-2-yl)-1H-imidazo[4,5-c]pyridin-2-yl]ethenyl]-6-[5-(pyrrolidin-1-ylmethyl)-3-pyridinyl]hepta-2,4,6-trien-3-amine |
| SMILES | C=C(/C(F)=C(C(=C)c1nc2c(-c3ccc(C(=C)C)s3)nccc2[nH]1)\C(N)=C/C)c1cncc(CN2CCCC2)c1 |
| InChI | InChI=1S/C32H33FN6S/c1-6-24(34)28(29(33)20(4)23-15-22(16-35-17-23)18-39-13-7-8-14-39)21(5)32-37-25-11-12-36-31(30(25)38-32)27-10-9-26(40-27)19(2)3/h6,9-12,15-17H,2,4-5,7-8,13-14,18,34H2,1,3H3,(H,37,38)/b24-6+,29-28+ |
| InChIKey | YJUWYCRIXWXWRG-ZMZWTGJGSA-N |
| XLogP | 7.52 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|