C25H31FO8 — CID 145042105
(2S,3S,4R,5R,6S)-2-[2,4-dimethoxy-5-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-6-(fluoromethyl)oxane-3,4,5-triol (PubChem CID 145042105) has the molecular formula C25H31FO8 and a molecular weight of 478.51 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-2-[2,4-dimethoxy-5-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-6-(fluoromethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R,6S)-2-[2,4-dimethoxy-5-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-6-(fluoromethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 145042105 |
| Molecular Formula | C25H31FO8 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (2S,3S,4R,5R,6S)-2-[2,4-dimethoxy-5-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-6-(fluoromethyl)oxane-3,4,5-triol |
| SMILES | COc1cc(OC)c([C@@H]2O[C@H](CF)[C@H](O)[C@H](O)[C@@H]2O)cc1Cc1ccc(O[C@H]2CCOC2)cc1 |
| InChI | InChI=1S/C25H31FO8/c1-30-19-11-20(31-2)18(25-24(29)23(28)22(27)21(12-26)34-25)10-15(19)9-14-3-5-16(6-4-14)33-17-7-8-32-13-17/h3-6,10-11,17,21-25,27-29H,7-9,12-13H2,1-2H3/t17-,21+,22-,23-,24-,25-/m0/s1 |
| InChIKey | QWROPGQRWPLIPU-SASYTRDLSA-N |
| XLogP | 1.95 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |